C11H16N2O — CID 131042784
3,5-dimethyl-N-(oxolan-3-yl)pyridin-2-amine (PubChem CID 131042784) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is 3,5-dimethyl-N-(oxolan-3-yl)pyridin-2-amine.
| Compound Name | 3,5-dimethyl-N-(oxolan-3-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 131042784 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | 3,5-dimethyl-N-(oxolan-3-yl)pyridin-2-amine |
| SMILES | Cc1cnc(NC2CCOC2)c(C)c1 |
| InChI | InChI=1S/C11H16N2O/c1-8-5-9(2)11(12-6-8)13-10-3-4-14-7-10/h5-6,10H,3-4,7H2,1-2H3,(H,12,13) |
| InChIKey | WURGKLIKTFNEIP-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |