C11H18N4O — CID 80853565
2-N-ethyl-5-methyl-4-N-(oxolan-3-yl)pyrimidine-2,4-diamine (PubChem CID 80853565) has the molecular formula C11H18N4O and a molecular weight of 222.29 g/mol. Its IUPAC name is 2-N-ethyl-5-methyl-4-N-(oxolan-3-yl)pyrimidine-2,4-diamine.
| Compound Name | 2-N-ethyl-5-methyl-4-N-(oxolan-3-yl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 80853565 |
| Molecular Formula | C11H18N4O |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.15 |
| IUPAC Name | 2-N-ethyl-5-methyl-4-N-(oxolan-3-yl)pyrimidine-2,4-diamine |
| SMILES | CCNc1ncc(C)c(NC2CCOC2)n1 |
| InChI | InChI=1S/C11H18N4O/c1-3-12-11-13-6-8(2)10(15-11)14-9-4-5-16-7-9/h6,9H,3-5,7H2,1-2H3,(H2,12,13,14,15) |
| InChIKey | XFQJIRBYFAROBL-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |