C12H19N3O — CID 142247308
3,6-diethyl-N-(oxolan-3-yl)pyrazin-2-amine (PubChem CID 142247308) has the molecular formula C12H19N3O and a molecular weight of 221.30 g/mol. Its IUPAC name is 3,6-diethyl-N-(oxolan-3-yl)pyrazin-2-amine.
| Compound Name | 3,6-diethyl-N-(oxolan-3-yl)pyrazin-2-amine |
|---|---|
| PubChem CID | 142247308 |
| Molecular Formula | C12H19N3O |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.15 |
| IUPAC Name | 3,6-diethyl-N-(oxolan-3-yl)pyrazin-2-amine |
| SMILES | CCc1cnc(CC)c(NC2CCOC2)n1 |
| InChI | InChI=1S/C12H19N3O/c1-3-9-7-13-11(4-2)12(14-9)15-10-5-6-16-8-10/h7,10H,3-6,8H2,1-2H3,(H,14,15) |
| InChIKey | BVBZHMRWZPTOKB-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |