C11H15BrN2O — CID 105366780
3-bromo-5-methyl-N-(oxolan-3-ylmethyl)pyridin-2-amine (PubChem CID 105366780) has the molecular formula C11H15BrN2O and a molecular weight of 271.16 g/mol. Its IUPAC name is 3-bromo-5-methyl-N-(oxolan-3-ylmethyl)pyridin-2-amine.
| Compound Name | 3-bromo-5-methyl-N-(oxolan-3-ylmethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 105366780 |
| Molecular Formula | C11H15BrN2O |
| Molecular Weight | 271.16 g/mol |
| Exact Mass | 270.04 |
| IUPAC Name | 3-bromo-5-methyl-N-(oxolan-3-ylmethyl)pyridin-2-amine |
| SMILES | Cc1cnc(NCC2CCOC2)c(Br)c1 |
| InChI | InChI=1S/C11H15BrN2O/c1-8-4-10(12)11(13-5-8)14-6-9-2-3-15-7-9/h4-5,9H,2-3,6-7H2,1H3,(H,13,14) |
| InChIKey | MXHMFHCXOBPSMG-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.16 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |