C11H16BrN3O — CID 104506777
3-bromo-4-methyl-2-N-(oxolan-3-ylmethyl)pyridine-2,5-diamine (PubChem CID 104506777) has the molecular formula C11H16BrN3O and a molecular weight of 286.17 g/mol. Its IUPAC name is 3-bromo-4-methyl-2-N-(oxolan-3-ylmethyl)pyridine-2,5-diamine.
| Compound Name | 3-bromo-4-methyl-2-N-(oxolan-3-ylmethyl)pyridine-2,5-diamine |
|---|---|
| PubChem CID | 104506777 |
| Molecular Formula | C11H16BrN3O |
| Molecular Weight | 286.17 g/mol |
| Exact Mass | 285.05 |
| IUPAC Name | 3-bromo-4-methyl-2-N-(oxolan-3-ylmethyl)pyridine-2,5-diamine |
| SMILES | Cc1c(N)cnc(NCC2CCOC2)c1Br |
| InChI | InChI=1S/C11H16BrN3O/c1-7-9(13)5-15-11(10(7)12)14-4-8-2-3-16-6-8/h5,8H,2-4,6,13H2,1H3,(H,14,15) |
| InChIKey | IHOQZJMPTGHFEC-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.17 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |