C12H19N3O — CID 63726632
3-methyl-2-N-(oxan-4-ylmethyl)pyridine-2,5-diamine (PubChem CID 63726632) has the molecular formula C12H19N3O and a molecular weight of 221.30 g/mol. Its IUPAC name is 3-methyl-2-N-(oxan-4-ylmethyl)pyridine-2,5-diamine.
| Compound Name | 3-methyl-2-N-(oxan-4-ylmethyl)pyridine-2,5-diamine |
|---|---|
| PubChem CID | 63726632 |
| Molecular Formula | C12H19N3O |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.15 |
| IUPAC Name | 3-methyl-2-N-(oxan-4-ylmethyl)pyridine-2,5-diamine |
| SMILES | Cc1cc(N)cnc1NCC1CCOCC1 |
| InChI | InChI=1S/C12H19N3O/c1-9-6-11(13)8-15-12(9)14-7-10-2-4-16-5-3-10/h6,8,10H,2-5,7,13H2,1H3,(H,14,15) |
| InChIKey | ISQRVEZXYKPJIU-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |