C11H17N3O — CID 62476856
3-methyl-2-N-(oxolan-2-ylmethyl)pyridine-2,5-diamine (PubChem CID 62476856) has the molecular formula C11H17N3O and a molecular weight of 207.28 g/mol. Its IUPAC name is 3-methyl-2-N-(oxolan-2-ylmethyl)pyridine-2,5-diamine.
| Compound Name | 3-methyl-2-N-(oxolan-2-ylmethyl)pyridine-2,5-diamine |
|---|---|
| PubChem CID | 62476856 |
| Molecular Formula | C11H17N3O |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | 3-methyl-2-N-(oxolan-2-ylmethyl)pyridine-2,5-diamine |
| SMILES | Cc1cc(N)cnc1NCC1CCCO1 |
| InChI | InChI=1S/C11H17N3O/c1-8-5-9(12)6-13-11(8)14-7-10-3-2-4-15-10/h5-6,10H,2-4,7,12H2,1H3,(H,13,14) |
| InChIKey | ORMGAPSZVLVLQU-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |