C10H14BrN3O — CID 62823635
5-bromo-2-N-(oxolan-3-ylmethyl)pyridine-2,3-diamine (PubChem CID 62823635) has the molecular formula C10H14BrN3O and a molecular weight of 272.15 g/mol. Its IUPAC name is 5-bromo-2-N-(oxolan-3-ylmethyl)pyridine-2,3-diamine.
| Compound Name | 5-bromo-2-N-(oxolan-3-ylmethyl)pyridine-2,3-diamine |
|---|---|
| PubChem CID | 62823635 |
| Molecular Formula | C10H14BrN3O |
| Molecular Weight | 272.15 g/mol |
| Exact Mass | 271.03 |
| IUPAC Name | 5-bromo-2-N-(oxolan-3-ylmethyl)pyridine-2,3-diamine |
| SMILES | Nc1cc(Br)cnc1NCC1CCOC1 |
| InChI | InChI=1S/C10H14BrN3O/c11-8-3-9(12)10(14-5-8)13-4-7-1-2-15-6-7/h3,5,7H,1-2,4,6,12H2,(H,13,14) |
| InChIKey | GOONPHAYUHBJFP-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.15 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |