C11H16BrN3O3S — CID 168730254
5-bromo-2-(oxan-4-ylmethylamino)pyridine-3-sulfonamide (PubChem CID 168730254) has the molecular formula C11H16BrN3O3S and a molecular weight of 350.24 g/mol. Its IUPAC name is 5-bromo-2-(oxan-4-ylmethylamino)pyridine-3-sulfonamide.
| Compound Name | 5-bromo-2-(oxan-4-ylmethylamino)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 168730254 |
| Molecular Formula | C11H16BrN3O3S |
| Molecular Weight | 350.24 g/mol |
| Exact Mass | 349.01 |
| IUPAC Name | 5-bromo-2-(oxan-4-ylmethylamino)pyridine-3-sulfonamide |
| SMILES | NS(=O)(=O)c1cc(Br)cnc1NCC1CCOCC1 |
| InChI | InChI=1S/C11H16BrN3O3S/c12-9-5-10(19(13,16)17)11(15-7-9)14-6-8-1-3-18-4-2-8/h5,7-8H,1-4,6H2,(H,14,15)(H2,13,16,17) |
| InChIKey | YOSFLTFYUJVGRJ-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.24 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |