C12H14BrF3N2O — CID 106796021
5-bromo-N-(oxan-3-ylmethyl)-3-(trifluoromethyl)pyridin-2-amine (PubChem CID 106796021) has the molecular formula C12H14BrF3N2O and a molecular weight of 339.16 g/mol. Its IUPAC name is 5-bromo-N-(oxan-3-ylmethyl)-3-(trifluoromethyl)pyridin-2-amine.
| Compound Name | 5-bromo-N-(oxan-3-ylmethyl)-3-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 106796021 |
| Molecular Formula | C12H14BrF3N2O |
| Molecular Weight | 339.16 g/mol |
| Exact Mass | 338.02 |
| IUPAC Name | 5-bromo-N-(oxan-3-ylmethyl)-3-(trifluoromethyl)pyridin-2-amine |
| SMILES | FC(F)(F)c1cc(Br)cnc1NCC1CCCOC1 |
| InChI | InChI=1S/C12H14BrF3N2O/c13-9-4-10(12(14,15)16)11(18-6-9)17-5-8-2-1-3-19-7-8/h4,6,8H,1-3,5,7H2,(H,17,18) |
| InChIKey | LCVLWGKOZDAOLV-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.16 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |