C11H12BrF3N2O — CID 106795986
5-bromo-N-(oxan-4-yl)-3-(trifluoromethyl)pyridin-2-amine (PubChem CID 106795986) has the molecular formula C11H12BrF3N2O and a molecular weight of 325.13 g/mol. Its IUPAC name is 5-bromo-N-(oxan-4-yl)-3-(trifluoromethyl)pyridin-2-amine.
| Compound Name | 5-bromo-N-(oxan-4-yl)-3-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 106795986 |
| Molecular Formula | C11H12BrF3N2O |
| Molecular Weight | 325.13 g/mol |
| Exact Mass | 324.01 |
| IUPAC Name | 5-bromo-N-(oxan-4-yl)-3-(trifluoromethyl)pyridin-2-amine |
| SMILES | FC(F)(F)c1cc(Br)cnc1NC1CCOCC1 |
| InChI | InChI=1S/C11H12BrF3N2O/c12-7-5-9(11(13,14)15)10(16-6-7)17-8-1-3-18-4-2-8/h5-6,8H,1-4H2,(H,16,17) |
| InChIKey | HNRYLPIRBNYGSR-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.13 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |