C13H14BrF3N2O2 — CID 122059880
4-[[5-bromo-3-(trifluoromethyl)-2-pyridinyl]amino]cyclohexane-1-carboxylic acid (PubChem CID 122059880) has the molecular formula C13H14BrF3N2O2 and a molecular weight of 367.17 g/mol. Its IUPAC name is 4-[[5-bromo-3-(trifluoromethyl)-2-pyridinyl]amino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[[5-bromo-3-(trifluoromethyl)-2-pyridinyl]amino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 122059880 |
| Molecular Formula | C13H14BrF3N2O2 |
| Molecular Weight | 367.17 g/mol |
| Exact Mass | 366.02 |
| IUPAC Name | 4-[[5-bromo-3-(trifluoromethyl)-2-pyridinyl]amino]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC(Nc2ncc(Br)cc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C13H14BrF3N2O2/c14-8-5-10(13(15,16)17)11(18-6-8)19-9-3-1-7(2-4-9)12(20)21/h5-7,9H,1-4H2,(H,18,19)(H,20,21) |
| InChIKey | NBACQUKFFCJWBG-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.17 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |