C14H18BrF3N2 — CID 106796001
5-bromo-N-(2-cyclohexylethyl)-3-(trifluoromethyl)pyridin-2-amine (PubChem CID 106796001) has the molecular formula C14H18BrF3N2 and a molecular weight of 351.21 g/mol. Its IUPAC name is 5-bromo-N-(2-cyclohexylethyl)-3-(trifluoromethyl)pyridin-2-amine.
| Compound Name | 5-bromo-N-(2-cyclohexylethyl)-3-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 106796001 |
| Molecular Formula | C14H18BrF3N2 |
| Molecular Weight | 351.21 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | 5-bromo-N-(2-cyclohexylethyl)-3-(trifluoromethyl)pyridin-2-amine |
| SMILES | FC(F)(F)c1cc(Br)cnc1NCCC1CCCCC1 |
| InChI | InChI=1S/C14H18BrF3N2/c15-11-8-12(14(16,17)18)13(20-9-11)19-7-6-10-4-2-1-3-5-10/h8-10H,1-7H2,(H,19,20) |
| InChIKey | FPLGNFVNDYQTNZ-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.21 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |