C14H20BrF3N2 — CID 106796309
5-bromo-N-octyl-3-(trifluoromethyl)pyridin-2-amine (PubChem CID 106796309) has the molecular formula C14H20BrF3N2 and a molecular weight of 353.23 g/mol. Its IUPAC name is 5-bromo-N-octyl-3-(trifluoromethyl)pyridin-2-amine.
| Compound Name | 5-bromo-N-octyl-3-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 106796309 |
| Molecular Formula | C14H20BrF3N2 |
| Molecular Weight | 353.23 g/mol |
| Exact Mass | 352.08 |
| IUPAC Name | 5-bromo-N-octyl-3-(trifluoromethyl)pyridin-2-amine |
| SMILES | CCCCCCCCNc1ncc(Br)cc1C(F)(F)F |
| InChI | InChI=1S/C14H20BrF3N2/c1-2-3-4-5-6-7-8-19-13-12(14(16,17)18)9-11(15)10-20-13/h9-10H,2-8H2,1H3,(H,19,20) |
| InChIKey | GBHOEEWOENKQKC-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.23 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|