C15H22BrF3N2 — CID 106796286
5-bromo-N-(2,2-dimethylheptyl)-3-(trifluoromethyl)pyridin-2-amine (PubChem CID 106796286) has the molecular formula C15H22BrF3N2 and a molecular weight of 367.25 g/mol. Its IUPAC name is 5-bromo-N-(2,2-dimethylheptyl)-3-(trifluoromethyl)pyridin-2-amine.
| Compound Name | 5-bromo-N-(2,2-dimethylheptyl)-3-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 106796286 |
| Molecular Formula | C15H22BrF3N2 |
| Molecular Weight | 367.25 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | 5-bromo-N-(2,2-dimethylheptyl)-3-(trifluoromethyl)pyridin-2-amine |
| SMILES | CCCCCC(C)(C)CNc1ncc(Br)cc1C(F)(F)F |
| InChI | InChI=1S/C15H22BrF3N2/c1-4-5-6-7-14(2,3)10-21-13-12(15(17,18)19)8-11(16)9-20-13/h8-9H,4-7,10H2,1-3H3,(H,20,21) |
| InChIKey | FNFRLKKDTSQZSK-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.25 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|