C11H15BrF3N3 — CID 106797276
1-N-[5-bromo-3-(trifluoromethyl)-2-pyridinyl]pentane-1,2-diamine (PubChem CID 106797276) has the molecular formula C11H15BrF3N3 and a molecular weight of 326.16 g/mol. Its IUPAC name is 1-N-[5-bromo-3-(trifluoromethyl)-2-pyridinyl]pentane-1,2-diamine.
| Compound Name | 1-N-[5-bromo-3-(trifluoromethyl)-2-pyridinyl]pentane-1,2-diamine |
|---|---|
| PubChem CID | 106797276 |
| Molecular Formula | C11H15BrF3N3 |
| Molecular Weight | 326.16 g/mol |
| Exact Mass | 325.04 |
| IUPAC Name | 1-N-[5-bromo-3-(trifluoromethyl)-2-pyridinyl]pentane-1,2-diamine |
| SMILES | CCCC(N)CNc1ncc(Br)cc1C(F)(F)F |
| InChI | InChI=1S/C11H15BrF3N3/c1-2-3-8(16)6-18-10-9(11(13,14)15)4-7(12)5-17-10/h4-5,8H,2-3,6,16H2,1H3,(H,17,18) |
| InChIKey | VFSUNKGXOTYVAK-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.16 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |