C9H7BrClF3N2 — CID 106796361
5-bromo-N-(2-chloroprop-2-enyl)-3-(trifluoromethyl)pyridin-2-amine (PubChem CID 106796361) has the molecular formula C9H7BrClF3N2 and a molecular weight of 315.52 g/mol. Its IUPAC name is 5-bromo-N-(2-chloroprop-2-enyl)-3-(trifluoromethyl)pyridin-2-amine.
| Compound Name | 5-bromo-N-(2-chloroprop-2-enyl)-3-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 106796361 |
| Molecular Formula | C9H7BrClF3N2 |
| Molecular Weight | 315.52 g/mol |
| Exact Mass | 313.94 |
| IUPAC Name | 5-bromo-N-(2-chloroprop-2-enyl)-3-(trifluoromethyl)pyridin-2-amine |
| SMILES | C=C(Cl)CNc1ncc(Br)cc1C(F)(F)F |
| InChI | InChI=1S/C9H7BrClF3N2/c1-5(11)3-15-8-7(9(12,13)14)2-6(10)4-16-8/h2,4H,1,3H2,(H,15,16) |
| InChIKey | ADTPWXXRLMAREJ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.52 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |