C13H16BrF3N2 — CID 106796000
5-bromo-N-(2-cyclopentylethyl)-3-(trifluoromethyl)pyridin-2-amine (PubChem CID 106796000) has the molecular formula C13H16BrF3N2 and a molecular weight of 337.18 g/mol. Its IUPAC name is 5-bromo-N-(2-cyclopentylethyl)-3-(trifluoromethyl)pyridin-2-amine.
| Compound Name | 5-bromo-N-(2-cyclopentylethyl)-3-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 106796000 |
| Molecular Formula | C13H16BrF3N2 |
| Molecular Weight | 337.18 g/mol |
| Exact Mass | 336.04 |
| IUPAC Name | 5-bromo-N-(2-cyclopentylethyl)-3-(trifluoromethyl)pyridin-2-amine |
| SMILES | FC(F)(F)c1cc(Br)cnc1NCCC1CCCC1 |
| InChI | InChI=1S/C13H16BrF3N2/c14-10-7-11(13(15,16)17)12(19-8-10)18-6-5-9-3-1-2-4-9/h7-9H,1-6H2,(H,18,19) |
| InChIKey | WAQIGYSVRMDXBW-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.18 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |