C11H14BrF3N2S — CID 106796371
5-bromo-N-(4-methylsulfanylbutan-2-yl)-3-(trifluoromethyl)pyridin-2-amine (PubChem CID 106796371) has the molecular formula C11H14BrF3N2S and a molecular weight of 343.21 g/mol. Its IUPAC name is 5-bromo-N-(4-methylsulfanylbutan-2-yl)-3-(trifluoromethyl)pyridin-2-amine.
| Compound Name | 5-bromo-N-(4-methylsulfanylbutan-2-yl)-3-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 106796371 |
| Molecular Formula | C11H14BrF3N2S |
| Molecular Weight | 343.21 g/mol |
| Exact Mass | 342.00 |
| IUPAC Name | 5-bromo-N-(4-methylsulfanylbutan-2-yl)-3-(trifluoromethyl)pyridin-2-amine |
| SMILES | CSCCC(C)Nc1ncc(Br)cc1C(F)(F)F |
| InChI | InChI=1S/C11H14BrF3N2S/c1-7(3-4-18-2)17-10-9(11(13,14)15)5-8(12)6-16-10/h5-7H,3-4H2,1-2H3,(H,16,17) |
| InChIKey | ZCWHLUGUQBAKPR-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.21 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |