C14H13BrF3N3 — CID 106796671
N-[1-(3-aminophenyl)ethyl]-5-bromo-3-(trifluoromethyl)pyridin-2-amine (PubChem CID 106796671) has the molecular formula C14H13BrF3N3 and a molecular weight of 360.18 g/mol. Its IUPAC name is N-[1-(3-aminophenyl)ethyl]-5-bromo-3-(trifluoromethyl)pyridin-2-amine.
| Compound Name | N-[1-(3-aminophenyl)ethyl]-5-bromo-3-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 106796671 |
| Molecular Formula | C14H13BrF3N3 |
| Molecular Weight | 360.18 g/mol |
| Exact Mass | 359.02 |
| IUPAC Name | N-[1-(3-aminophenyl)ethyl]-5-bromo-3-(trifluoromethyl)pyridin-2-amine |
| SMILES | CC(Nc1ncc(Br)cc1C(F)(F)F)c1cccc(N)c1 |
| InChI | InChI=1S/C14H13BrF3N3/c1-8(9-3-2-4-11(19)5-9)21-13-12(14(16,17)18)6-10(15)7-20-13/h2-8H,19H2,1H3,(H,20,21) |
| InChIKey | NZGIVJNAULFFFI-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.18 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|