C11H11F3N4S — CID 114450019
N-[1-(3-aminophenyl)ethyl]-5-(trifluoromethyl)-1,3,4-thiadiazol-2-amine (PubChem CID 114450019) has the molecular formula C11H11F3N4S and a molecular weight of 288.30 g/mol. Its IUPAC name is N-[1-(3-aminophenyl)ethyl]-5-(trifluoromethyl)-1,3,4-thiadiazol-2-amine.
| Compound Name | N-[1-(3-aminophenyl)ethyl]-5-(trifluoromethyl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 114450019 |
| Molecular Formula | C11H11F3N4S |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | N-[1-(3-aminophenyl)ethyl]-5-(trifluoromethyl)-1,3,4-thiadiazol-2-amine |
| SMILES | CC(Nc1nnc(C(F)(F)F)s1)c1cccc(N)c1 |
| InChI | InChI=1S/C11H11F3N4S/c1-6(7-3-2-4-8(15)5-7)16-10-18-17-9(19-10)11(12,13)14/h2-6H,15H2,1H3,(H,16,18) |
| InChIKey | LPJFLZNBSOHDJB-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|