C9H5Cl2F3N4S — CID 19932779
2,6-dichloro-1-N-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]benzene-1,4-diamine (PubChem CID 19932779) has the molecular formula C9H5Cl2F3N4S and a molecular weight of 329.13 g/mol. Its IUPAC name is 2,6-dichloro-1-N-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]benzene-1,4-diamine.
| Compound Name | 2,6-dichloro-1-N-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 19932779 |
| Molecular Formula | C9H5Cl2F3N4S |
| Molecular Weight | 329.13 g/mol |
| Exact Mass | 327.96 |
| IUPAC Name | 2,6-dichloro-1-N-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]benzene-1,4-diamine |
| SMILES | Nc1cc(Cl)c(Nc2nnc(C(F)(F)F)s2)c(Cl)c1 |
| InChI | InChI=1S/C9H5Cl2F3N4S/c10-4-1-3(15)2-5(11)6(4)16-8-18-17-7(19-8)9(12,13)14/h1-2H,15H2,(H,16,18) |
| InChIKey | FKNQJENKNVRMKE-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.13 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|