C15H26BrN3 — CID 142246876
5-bromo-3-N-methyl-2-N-nonylpyridine-2,3-diamine (PubChem CID 142246876) has the molecular formula C15H26BrN3 and a molecular weight of 328.30 g/mol. Its IUPAC name is 5-bromo-3-N-methyl-2-N-nonylpyridine-2,3-diamine.
| Compound Name | 5-bromo-3-N-methyl-2-N-nonylpyridine-2,3-diamine |
|---|---|
| PubChem CID | 142246876 |
| Molecular Formula | C15H26BrN3 |
| Molecular Weight | 328.30 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 5-bromo-3-N-methyl-2-N-nonylpyridine-2,3-diamine |
| SMILES | CCCCCCCCCNc1ncc(Br)cc1NC |
| InChI | InChI=1S/C15H26BrN3/c1-3-4-5-6-7-8-9-10-18-15-14(17-2)11-13(16)12-19-15/h11-12,17H,3-10H2,1-2H3,(H,18,19) |
| InChIKey | GDLRPRLCGZOYMH-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.30 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|