C16H28IN3 — CID 157403237
3-N-decyl-5-iodo-2-N-methylpyridine-2,3-diamine (PubChem CID 157403237) has the molecular formula C16H28IN3 and a molecular weight of 389.33 g/mol. Its IUPAC name is 3-N-decyl-5-iodo-2-N-methylpyridine-2,3-diamine.
| Compound Name | 3-N-decyl-5-iodo-2-N-methylpyridine-2,3-diamine |
|---|---|
| PubChem CID | 157403237 |
| Molecular Formula | C16H28IN3 |
| Molecular Weight | 389.33 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | 3-N-decyl-5-iodo-2-N-methylpyridine-2,3-diamine |
| SMILES | CCCCCCCCCCNc1cc(I)cnc1NC |
| InChI | InChI=1S/C16H28IN3/c1-3-4-5-6-7-8-9-10-11-19-15-12-14(17)13-20-16(15)18-2/h12-13,19H,3-11H2,1-2H3,(H,18,20) |
| InChIKey | UUSQWIRLMYMRBN-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.33 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|