C14H17F3N2O4S — CID 122060090
4-[4-sulfamoyl-2-(trifluoromethyl)anilino]cyclohexane-1-carboxylic acid (PubChem CID 122060090) has the molecular formula C14H17F3N2O4S and a molecular weight of 366.36 g/mol. Its IUPAC name is 4-[4-sulfamoyl-2-(trifluoromethyl)anilino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[4-sulfamoyl-2-(trifluoromethyl)anilino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 122060090 |
| Molecular Formula | C14H17F3N2O4S |
| Molecular Weight | 366.36 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | 4-[4-sulfamoyl-2-(trifluoromethyl)anilino]cyclohexane-1-carboxylic acid |
| SMILES | NS(=O)(=O)c1ccc(NC2CCC(C(=O)O)CC2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H17F3N2O4S/c15-14(16,17)11-7-10(24(18,22)23)5-6-12(11)19-9-3-1-8(2-4-9)13(20)21/h5-9,19H,1-4H2,(H,20,21)(H2,18,22,23) |
| InChIKey | YXQAZLFSSQTJST-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.36 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |