C13H18F3N3O4S2 — CID 67170062
4-[(1-methylpiperidin-4-yl)amino]-3-(trifluoromethylsulfonyl)benzenesulfonamide (PubChem CID 67170062) has the molecular formula C13H18F3N3O4S2 and a molecular weight of 401.43 g/mol. Its IUPAC name is 4-[(1-methylpiperidin-4-yl)amino]-3-(trifluoromethylsulfonyl)benzenesulfonamide.
| Compound Name | 4-[(1-methylpiperidin-4-yl)amino]-3-(trifluoromethylsulfonyl)benzenesulfonamide |
|---|---|
| PubChem CID | 67170062 |
| Molecular Formula | C13H18F3N3O4S2 |
| Molecular Weight | 401.43 g/mol |
| Exact Mass | 401.07 |
| IUPAC Name | 4-[(1-methylpiperidin-4-yl)amino]-3-(trifluoromethylsulfonyl)benzenesulfonamide |
| SMILES | CN1CCC(Nc2ccc(S(N)(=O)=O)cc2S(=O)(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C13H18F3N3O4S2/c1-19-6-4-9(5-7-19)18-11-3-2-10(25(17,22)23)8-12(11)24(20,21)13(14,15)16/h2-3,8-9,18H,4-7H2,1H3,(H2,17,22,23) |
| InChIKey | VSRNMRQZIZNLKW-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.43 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |