C14H22N2O4S2 — CID 51074560
N-[2,4-bis(methylsulfonyl)phenyl]-1-methylpiperidin-4-amine (PubChem CID 51074560) has the molecular formula C14H22N2O4S2 and a molecular weight of 346.47 g/mol. Its IUPAC name is N-[2,4-bis(methylsulfonyl)phenyl]-1-methylpiperidin-4-amine.
| Compound Name | N-[2,4-bis(methylsulfonyl)phenyl]-1-methylpiperidin-4-amine |
|---|---|
| PubChem CID | 51074560 |
| Molecular Formula | C14H22N2O4S2 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | N-[2,4-bis(methylsulfonyl)phenyl]-1-methylpiperidin-4-amine |
| SMILES | CN1CCC(Nc2ccc(S(C)(=O)=O)cc2S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C14H22N2O4S2/c1-16-8-6-11(7-9-16)15-13-5-4-12(21(2,17)18)10-14(13)22(3,19)20/h4-5,10-11,15H,6-9H2,1-3H3 |
| InChIKey | OXCATQFTESLBRE-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |