C19H29NO4S2 — CID 133306325
N-(dicyclopentylmethyl)-2,4-bis(methylsulfonyl)aniline (PubChem CID 133306325) has the molecular formula C19H29NO4S2 and a molecular weight of 399.58 g/mol. Its IUPAC name is N-(dicyclopentylmethyl)-2,4-bis(methylsulfonyl)aniline.
| Compound Name | N-(dicyclopentylmethyl)-2,4-bis(methylsulfonyl)aniline |
|---|---|
| PubChem CID | 133306325 |
| Molecular Formula | C19H29NO4S2 |
| Molecular Weight | 399.58 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | N-(dicyclopentylmethyl)-2,4-bis(methylsulfonyl)aniline |
| SMILES | CS(=O)(=O)c1ccc(NC(C2CCCC2)C2CCCC2)c(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C19H29NO4S2/c1-25(21,22)16-11-12-17(18(13-16)26(2,23)24)20-19(14-7-3-4-8-14)15-9-5-6-10-15/h11-15,19-20H,3-10H2,1-2H3 |
| InChIKey | JZSSKWCFTQAVFU-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.58 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |