C14H21NO6S2 — CID 122049106
(2R)-2-[2,4-bis(methylsulfonyl)anilino]-4-methylpentanoic acid (PubChem CID 122049106) has the molecular formula C14H21NO6S2 and a molecular weight of 363.46 g/mol. Its IUPAC name is (2R)-2-[2,4-bis(methylsulfonyl)anilino]-4-methylpentanoic acid.
| Compound Name | (2R)-2-[2,4-bis(methylsulfonyl)anilino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 122049106 |
| Molecular Formula | C14H21NO6S2 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | (2R)-2-[2,4-bis(methylsulfonyl)anilino]-4-methylpentanoic acid |
| SMILES | CC(C)C[C@@H](Nc1ccc(S(C)(=O)=O)cc1S(C)(=O)=O)C(=O)O |
| InChI | InChI=1S/C14H21NO6S2/c1-9(2)7-12(14(16)17)15-11-6-5-10(22(3,18)19)8-13(11)23(4,20)21/h5-6,8-9,12,15H,7H2,1-4H3,(H,16,17)/t12-/m1/s1 |
| InChIKey | NDXHIVBVFLSUTM-GFCCVEGCSA-N |
| XLogP | 1.40 |
| TPSA | 117.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |