C15H19F2NO5S — CID 119363039
(2R)-2-[[2-[4-(difluoromethylsulfonyl)phenyl]acetyl]amino]-4-methylpentanoic acid (PubChem CID 119363039) has the molecular formula C15H19F2NO5S and a molecular weight of 363.38 g/mol. Its IUPAC name is (2R)-2-[[2-[4-(difluoromethylsulfonyl)phenyl]acetyl]amino]-4-methylpentanoic acid.
| Compound Name | (2R)-2-[[2-[4-(difluoromethylsulfonyl)phenyl]acetyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 119363039 |
| Molecular Formula | C15H19F2NO5S |
| Molecular Weight | 363.38 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | (2R)-2-[[2-[4-(difluoromethylsulfonyl)phenyl]acetyl]amino]-4-methylpentanoic acid |
| SMILES | CC(C)C[C@@H](NC(=O)Cc1ccc(S(=O)(=O)C(F)F)cc1)C(=O)O |
| InChI | InChI=1S/C15H19F2NO5S/c1-9(2)7-12(14(20)21)18-13(19)8-10-3-5-11(6-4-10)24(22,23)15(16)17/h3-6,9,12,15H,7-8H2,1-2H3,(H,18,19)(H,20,21)/t12-/m1/s1 |
| InChIKey | CHHSMUKLAYLXHB-GFCCVEGCSA-N |
| XLogP | 1.84 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.38 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |