C11H11F2NO5S — CID 119349957
2-[[2-[4-(difluoromethylsulfonyl)phenyl]acetyl]amino]acetic acid (PubChem CID 119349957) has the molecular formula C11H11F2NO5S and a molecular weight of 307.27 g/mol. Its IUPAC name is 2-[[2-[4-(difluoromethylsulfonyl)phenyl]acetyl]amino]acetic acid.
| Compound Name | 2-[[2-[4-(difluoromethylsulfonyl)phenyl]acetyl]amino]acetic acid |
|---|---|
| PubChem CID | 119349957 |
| Molecular Formula | C11H11F2NO5S |
| Molecular Weight | 307.27 g/mol |
| Exact Mass | 307.03 |
| IUPAC Name | 2-[[2-[4-(difluoromethylsulfonyl)phenyl]acetyl]amino]acetic acid |
| SMILES | O=C(O)CNC(=O)Cc1ccc(S(=O)(=O)C(F)F)cc1 |
| InChI | InChI=1S/C11H11F2NO5S/c12-11(13)20(18,19)8-3-1-7(2-4-8)5-9(15)14-6-10(16)17/h1-4,11H,5-6H2,(H,14,15)(H,16,17) |
| InChIKey | XLZBTRVBHSNVIV-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.27 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |