C14H18F2N2O3S — CID 119511600
2-[4-(difluoromethylsulfonyl)phenyl]-N-(pyrrolidin-2-ylmethyl)acetamide (PubChem CID 119511600) has the molecular formula C14H18F2N2O3S and a molecular weight of 332.37 g/mol. Its IUPAC name is 2-[4-(difluoromethylsulfonyl)phenyl]-N-(pyrrolidin-2-ylmethyl)acetamide.
| Compound Name | 2-[4-(difluoromethylsulfonyl)phenyl]-N-(pyrrolidin-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 119511600 |
| Molecular Formula | C14H18F2N2O3S |
| Molecular Weight | 332.37 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | 2-[4-(difluoromethylsulfonyl)phenyl]-N-(pyrrolidin-2-ylmethyl)acetamide |
| SMILES | O=C(Cc1ccc(S(=O)(=O)C(F)F)cc1)NCC1CCCN1 |
| InChI | InChI=1S/C14H18F2N2O3S/c15-14(16)22(20,21)12-5-3-10(4-6-12)8-13(19)18-9-11-2-1-7-17-11/h3-6,11,14,17H,1-2,7-9H2,(H,18,19) |
| InChIKey | CTCIQWMVLHOBMO-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.37 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |