C8H7BF2O2S — CID 162598602
CID 162598602 (PubChem CID 162598602) has the molecular formula C8H7BF2O2S and a molecular weight of 216.02 g/mol.
| Compound Name | CID 162598602 |
|---|---|
| PubChem CID | 162598602 |
| Molecular Formula | C8H7BF2O2S |
| Molecular Weight | 216.02 g/mol |
| Exact Mass | 216.02 |
| IUPAC Name | — |
| SMILES | [B]Cc1ccc(S(=O)(=O)C(F)F)cc1 |
| InChI | InChI=1S/C8H7BF2O2S/c9-5-6-1-3-7(4-2-6)14(12,13)8(10)11/h1-4,8H,5H2 |
| InChIKey | MNWOWHABRZTOKG-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.02 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|