C16H25F2NO2S — CID 112820223
N-[[4-(difluoromethylsulfonyl)phenyl]methyl]-2-methyl-N-(2-methylpropyl)propan-1-amine (PubChem CID 112820223) has the molecular formula C16H25F2NO2S and a molecular weight of 333.44 g/mol. Its IUPAC name is N-[[4-(difluoromethylsulfonyl)phenyl]methyl]-2-methyl-N-(2-methylpropyl)propan-1-amine.
| Compound Name | N-[[4-(difluoromethylsulfonyl)phenyl]methyl]-2-methyl-N-(2-methylpropyl)propan-1-amine |
|---|---|
| PubChem CID | 112820223 |
| Molecular Formula | C16H25F2NO2S |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | N-[[4-(difluoromethylsulfonyl)phenyl]methyl]-2-methyl-N-(2-methylpropyl)propan-1-amine |
| SMILES | CC(C)CN(Cc1ccc(S(=O)(=O)C(F)F)cc1)CC(C)C |
| InChI | InChI=1S/C16H25F2NO2S/c1-12(2)9-19(10-13(3)4)11-14-5-7-15(8-6-14)22(20,21)16(17)18/h5-8,12-13,16H,9-11H2,1-4H3 |
| InChIKey | XRZXYRJYBJCACI-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |