C11H14F2O5S2 — CID 167908895
1-[[4-(difluoromethylsulfonyl)phenyl]methylsulfonyl]propan-2-ol (PubChem CID 167908895) has the molecular formula C11H14F2O5S2 and a molecular weight of 328.36 g/mol. Its IUPAC name is 1-[[4-(difluoromethylsulfonyl)phenyl]methylsulfonyl]propan-2-ol.
| Compound Name | 1-[[4-(difluoromethylsulfonyl)phenyl]methylsulfonyl]propan-2-ol |
|---|---|
| PubChem CID | 167908895 |
| Molecular Formula | C11H14F2O5S2 |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.03 |
| IUPAC Name | 1-[[4-(difluoromethylsulfonyl)phenyl]methylsulfonyl]propan-2-ol |
| SMILES | CC(O)CS(=O)(=O)Cc1ccc(S(=O)(=O)C(F)F)cc1 |
| InChI | InChI=1S/C11H14F2O5S2/c1-8(14)6-19(15,16)7-9-2-4-10(5-3-9)20(17,18)11(12)13/h2-5,8,11,14H,6-7H2,1H3 |
| InChIKey | GWMIAKXRYWQSJN-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |