C14H21F2NO2S — CID 63198472
1-[4-(difluoromethylsulfonyl)phenyl]-N,3,3-trimethylbutan-2-amine (PubChem CID 63198472) has the molecular formula C14H21F2NO2S and a molecular weight of 305.39 g/mol. Its IUPAC name is 1-[4-(difluoromethylsulfonyl)phenyl]-N,3,3-trimethylbutan-2-amine.
| Compound Name | 1-[4-(difluoromethylsulfonyl)phenyl]-N,3,3-trimethylbutan-2-amine |
|---|---|
| PubChem CID | 63198472 |
| Molecular Formula | C14H21F2NO2S |
| Molecular Weight | 305.39 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | 1-[4-(difluoromethylsulfonyl)phenyl]-N,3,3-trimethylbutan-2-amine |
| SMILES | CNC(Cc1ccc(S(=O)(=O)C(F)F)cc1)C(C)(C)C |
| InChI | InChI=1S/C14H21F2NO2S/c1-14(2,3)12(17-4)9-10-5-7-11(8-6-10)20(18,19)13(15)16/h5-8,12-13,17H,9H2,1-4H3 |
| InChIKey | PAJISXOCNBLJHO-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.39 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |