C13H15F2NO5S — CID 119352372
4-[[2-[4-(difluoromethylsulfonyl)phenyl]acetyl]amino]butanoic acid (PubChem CID 119352372) has the molecular formula C13H15F2NO5S and a molecular weight of 335.33 g/mol. Its IUPAC name is 4-[[2-[4-(difluoromethylsulfonyl)phenyl]acetyl]amino]butanoic acid.
| Compound Name | 4-[[2-[4-(difluoromethylsulfonyl)phenyl]acetyl]amino]butanoic acid |
|---|---|
| PubChem CID | 119352372 |
| Molecular Formula | C13H15F2NO5S |
| Molecular Weight | 335.33 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | 4-[[2-[4-(difluoromethylsulfonyl)phenyl]acetyl]amino]butanoic acid |
| SMILES | O=C(O)CCCNC(=O)Cc1ccc(S(=O)(=O)C(F)F)cc1 |
| InChI | InChI=1S/C13H15F2NO5S/c14-13(15)22(20,21)10-5-3-9(4-6-10)8-11(17)16-7-1-2-12(18)19/h3-6,13H,1-2,7-8H2,(H,16,17)(H,18,19) |
| InChIKey | SCCAZODTFOBJMV-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.33 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|