C15H22N2O5S — CID 119361436
(2S)-2-[[2-[3-(methanesulfonamido)phenyl]acetyl]amino]-4-methylpentanoic acid (PubChem CID 119361436) has the molecular formula C15H22N2O5S and a molecular weight of 342.42 g/mol. Its IUPAC name is (2S)-2-[[2-[3-(methanesulfonamido)phenyl]acetyl]amino]-4-methylpentanoic acid.
| Compound Name | (2S)-2-[[2-[3-(methanesulfonamido)phenyl]acetyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 119361436 |
| Molecular Formula | C15H22N2O5S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | (2S)-2-[[2-[3-(methanesulfonamido)phenyl]acetyl]amino]-4-methylpentanoic acid |
| SMILES | CC(C)C[C@H](NC(=O)Cc1cccc(NS(C)(=O)=O)c1)C(=O)O |
| InChI | InChI=1S/C15H22N2O5S/c1-10(2)7-13(15(19)20)16-14(18)9-11-5-4-6-12(8-11)17-23(3,21)22/h4-6,8,10,13,17H,7,9H2,1-3H3,(H,16,18)(H,19,20)/t13-/m0/s1 |
| InChIKey | XINVHQFJRFFHNH-ZDUSSCGKSA-N |
| XLogP | 1.22 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |