C16H24F3N3O4S2 — CID 174913855
1-(2-methylpropyl)-4-[4-(sulfinoamino)-2-(trifluoromethylsulfonyl)anilino]piperidine (PubChem CID 174913855) has the molecular formula C16H24F3N3O4S2 and a molecular weight of 443.51 g/mol. Its IUPAC name is 1-(2-methylpropyl)-4-[4-(sulfinoamino)-2-(trifluoromethylsulfonyl)anilino]piperidine.
| Compound Name | 1-(2-methylpropyl)-4-[4-(sulfinoamino)-2-(trifluoromethylsulfonyl)anilino]piperidine |
|---|---|
| PubChem CID | 174913855 |
| Molecular Formula | C16H24F3N3O4S2 |
| Molecular Weight | 443.51 g/mol |
| Exact Mass | 443.12 |
| IUPAC Name | 1-(2-methylpropyl)-4-[4-(sulfinoamino)-2-(trifluoromethylsulfonyl)anilino]piperidine |
| SMILES | CC(C)CN1CCC(Nc2ccc(NS(=O)O)cc2S(=O)(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C16H24F3N3O4S2/c1-11(2)10-22-7-5-12(6-8-22)20-14-4-3-13(21-27(23)24)9-15(14)28(25,26)16(17,18)19/h3-4,9,11-12,20-21H,5-8,10H2,1-2H3,(H,23,24) |
| InChIKey | FJRNPZUZDFJVTM-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.51 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|