C11H14F3N3O5S2 — CID 166400127
1-propyl-3-[4-sulfamoyl-2-(trifluoromethylsulfonyl)phenyl]urea (PubChem CID 166400127) has the molecular formula C11H14F3N3O5S2 and a molecular weight of 389.38 g/mol. Its IUPAC name is 1-propyl-3-[4-sulfamoyl-2-(trifluoromethylsulfonyl)phenyl]urea.
| Compound Name | 1-propyl-3-[4-sulfamoyl-2-(trifluoromethylsulfonyl)phenyl]urea |
|---|---|
| PubChem CID | 166400127 |
| Molecular Formula | C11H14F3N3O5S2 |
| Molecular Weight | 389.38 g/mol |
| Exact Mass | 389.03 |
| IUPAC Name | 1-propyl-3-[4-sulfamoyl-2-(trifluoromethylsulfonyl)phenyl]urea |
| SMILES | CCCNC(=O)Nc1ccc(S(N)(=O)=O)cc1S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C11H14F3N3O5S2/c1-2-5-16-10(18)17-8-4-3-7(24(15,21)22)6-9(8)23(19,20)11(12,13)14/h3-4,6H,2,5H2,1H3,(H2,15,21,22)(H2,16,17,18) |
| InChIKey | FSXAALPNFGEFKX-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 135.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.38 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |