C10H12F3N3O6S2 — CID 167835757
1-(2-hydroxyethyl)-3-[4-sulfamoyl-2-(trifluoromethylsulfonyl)phenyl]urea (PubChem CID 167835757) has the molecular formula C10H12F3N3O6S2 and a molecular weight of 391.35 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-3-[4-sulfamoyl-2-(trifluoromethylsulfonyl)phenyl]urea.
| Compound Name | 1-(2-hydroxyethyl)-3-[4-sulfamoyl-2-(trifluoromethylsulfonyl)phenyl]urea |
|---|---|
| PubChem CID | 167835757 |
| Molecular Formula | C10H12F3N3O6S2 |
| Molecular Weight | 391.35 g/mol |
| Exact Mass | 391.01 |
| IUPAC Name | 1-(2-hydroxyethyl)-3-[4-sulfamoyl-2-(trifluoromethylsulfonyl)phenyl]urea |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)NCCO)c(S(=O)(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C10H12F3N3O6S2/c11-10(12,13)23(19,20)8-5-6(24(14,21)22)1-2-7(8)16-9(18)15-3-4-17/h1-2,5,17H,3-4H2,(H2,14,21,22)(H2,15,16,18) |
| InChIKey | PNBMMYVIYDDVTP-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 155.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.35 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |