C12H14F3N3O5S2 — CID 174689558
4-(4-oxa-1-azabicyclo[3.1.0]hexan-5-ylmethylamino)-3-(trifluoromethylsulfonyl)benzenesulfonamide (PubChem CID 174689558) has the molecular formula C12H14F3N3O5S2 and a molecular weight of 401.39 g/mol. Its IUPAC name is 4-(4-oxa-1-azabicyclo[3.1.0]hexan-5-ylmethylamino)-3-(trifluoromethylsulfonyl)benzenesulfonamide.
| Compound Name | 4-(4-oxa-1-azabicyclo[3.1.0]hexan-5-ylmethylamino)-3-(trifluoromethylsulfonyl)benzenesulfonamide |
|---|---|
| PubChem CID | 174689558 |
| Molecular Formula | C12H14F3N3O5S2 |
| Molecular Weight | 401.39 g/mol |
| Exact Mass | 401.03 |
| IUPAC Name | 4-(4-oxa-1-azabicyclo[3.1.0]hexan-5-ylmethylamino)-3-(trifluoromethylsulfonyl)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(NCC23CN2CCO3)c(S(=O)(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C12H14F3N3O5S2/c13-12(14,15)24(19,20)10-5-8(25(16,21)22)1-2-9(10)17-6-11-7-18(11)3-4-23-11/h1-2,5,17H,3-4,6-7H2,(H2,16,21,22) |
| InChIKey | BYVHJHNTHRTUAM-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 118.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.39 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|