C13H17F3N2O5S2 — CID 166652666
4-(oxan-3-ylmethylamino)-3-(trifluoromethylsulfonyl)benzenesulfonamide (PubChem CID 166652666) has the molecular formula C13H17F3N2O5S2 and a molecular weight of 402.42 g/mol. Its IUPAC name is 4-(oxan-3-ylmethylamino)-3-(trifluoromethylsulfonyl)benzenesulfonamide.
| Compound Name | 4-(oxan-3-ylmethylamino)-3-(trifluoromethylsulfonyl)benzenesulfonamide |
|---|---|
| PubChem CID | 166652666 |
| Molecular Formula | C13H17F3N2O5S2 |
| Molecular Weight | 402.42 g/mol |
| Exact Mass | 402.05 |
| IUPAC Name | 4-(oxan-3-ylmethylamino)-3-(trifluoromethylsulfonyl)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(NCC2CCCOC2)c(S(=O)(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C13H17F3N2O5S2/c14-13(15,16)24(19,20)12-6-10(25(17,21)22)3-4-11(12)18-7-9-2-1-5-23-8-9/h3-4,6,9,18H,1-2,5,7-8H2,(H2,17,21,22) |
| InChIKey | FWZSPGKCMMHTRD-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.42 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |