C13H15F4NO3S — CID 47072817
4-fluoro-N-(oxan-3-ylmethyl)-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 47072817) has the molecular formula C13H15F4NO3S and a molecular weight of 341.33 g/mol. Its IUPAC name is 4-fluoro-N-(oxan-3-ylmethyl)-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | 4-fluoro-N-(oxan-3-ylmethyl)-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 47072817 |
| Molecular Formula | C13H15F4NO3S |
| Molecular Weight | 341.33 g/mol |
| Exact Mass | 341.07 |
| IUPAC Name | 4-fluoro-N-(oxan-3-ylmethyl)-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | O=S(=O)(NCC1CCCOC1)c1ccc(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H15F4NO3S/c14-12-4-3-10(6-11(12)13(15,16)17)22(19,20)18-7-9-2-1-5-21-8-9/h3-4,6,9,18H,1-2,5,7-8H2 |
| InChIKey | LGTVSIHNMJIGRM-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.33 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |