C13H17NO5S — CID 51892056
4-[[(3S)-oxan-3-yl]methylsulfamoyl]benzoic acid (PubChem CID 51892056) has the molecular formula C13H17NO5S and a molecular weight of 299.35 g/mol. Its IUPAC name is 4-[[(3S)-oxan-3-yl]methylsulfamoyl]benzoic acid.
| Compound Name | 4-[[(3S)-oxan-3-yl]methylsulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 51892056 |
| Molecular Formula | C13H17NO5S |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | 4-[[(3S)-oxan-3-yl]methylsulfamoyl]benzoic acid |
| SMILES | O=C(O)c1ccc(S(=O)(=O)NC[C@@H]2CCCOC2)cc1 |
| InChI | InChI=1S/C13H17NO5S/c15-13(16)11-3-5-12(6-4-11)20(17,18)14-8-10-2-1-7-19-9-10/h3-6,10,14H,1-2,7-9H2,(H,15,16)/t10-/m0/s1 |
| InChIKey | IPWJHDYQFPJSMP-JTQLQIEISA-N |
| XLogP | 1.09 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |