C11H16N2O4S — CID 54905708
N-(oxan-3-ylmethyl)-6-oxo-1H-pyridine-3-sulfonamide (PubChem CID 54905708) has the molecular formula C11H16N2O4S and a molecular weight of 272.33 g/mol. Its IUPAC name is N-(oxan-3-ylmethyl)-6-oxo-1H-pyridine-3-sulfonamide.
| Compound Name | N-(oxan-3-ylmethyl)-6-oxo-1H-pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 54905708 |
| Molecular Formula | C11H16N2O4S |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | N-(oxan-3-ylmethyl)-6-oxo-1H-pyridine-3-sulfonamide |
| SMILES | O=c1ccc(S(=O)(=O)NCC2CCCOC2)c[nH]1 |
| InChI | InChI=1S/C11H16N2O4S/c14-11-4-3-10(7-12-11)18(15,16)13-6-9-2-1-5-17-8-9/h3-4,7,9,13H,1-2,5-6,8H2,(H,12,14) |
| InChIKey | RXOYTRDWZXRJDB-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 88.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |