C12H13F4NO3S — CID 63363472
N-[4-fluoro-2-(trifluoromethylsulfonyl)phenyl]oxan-3-amine (PubChem CID 63363472) has the molecular formula C12H13F4NO3S and a molecular weight of 327.30 g/mol. Its IUPAC name is N-[4-fluoro-2-(trifluoromethylsulfonyl)phenyl]oxan-3-amine.
| Compound Name | N-[4-fluoro-2-(trifluoromethylsulfonyl)phenyl]oxan-3-amine |
|---|---|
| PubChem CID | 63363472 |
| Molecular Formula | C12H13F4NO3S |
| Molecular Weight | 327.30 g/mol |
| Exact Mass | 327.06 |
| IUPAC Name | N-[4-fluoro-2-(trifluoromethylsulfonyl)phenyl]oxan-3-amine |
| SMILES | O=S(=O)(c1cc(F)ccc1NC1CCCOC1)C(F)(F)F |
| InChI | InChI=1S/C12H13F4NO3S/c13-8-3-4-10(17-9-2-1-5-20-7-9)11(6-8)21(18,19)12(14,15)16/h3-4,6,9,17H,1-2,5,7H2 |
| InChIKey | SOCRDFGEVQZULN-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.30 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |