C12H12F4N2O2S — CID 62893012
N-[4-fluoro-2-(trifluoromethylsulfonyl)phenyl]-3-azabicyclo[3.1.0]hexan-6-amine (PubChem CID 62893012) has the molecular formula C12H12F4N2O2S and a molecular weight of 324.30 g/mol. Its IUPAC name is N-[4-fluoro-2-(trifluoromethylsulfonyl)phenyl]-3-azabicyclo[3.1.0]hexan-6-amine.
| Compound Name | N-[4-fluoro-2-(trifluoromethylsulfonyl)phenyl]-3-azabicyclo[3.1.0]hexan-6-amine |
|---|---|
| PubChem CID | 62893012 |
| Molecular Formula | C12H12F4N2O2S |
| Molecular Weight | 324.30 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | N-[4-fluoro-2-(trifluoromethylsulfonyl)phenyl]-3-azabicyclo[3.1.0]hexan-6-amine |
| SMILES | O=S(=O)(c1cc(F)ccc1NC1C2CNCC21)C(F)(F)F |
| InChI | InChI=1S/C12H12F4N2O2S/c13-6-1-2-9(18-11-7-4-17-5-8(7)11)10(3-6)21(19,20)12(14,15)16/h1-3,7-8,11,17-18H,4-5H2 |
| InChIKey | DAHATERNQVGFMI-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.30 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |