C14H16F4N2O2S — CID 100642163
N-[2-(3,6-dihydro-2H-pyridin-1-yl)ethyl]-4-fluoro-2-(trifluoromethylsulfonyl)aniline (PubChem CID 100642163) has the molecular formula C14H16F4N2O2S and a molecular weight of 352.35 g/mol. Its IUPAC name is N-[2-(3,6-dihydro-2H-pyridin-1-yl)ethyl]-4-fluoro-2-(trifluoromethylsulfonyl)aniline.
| Compound Name | N-[2-(3,6-dihydro-2H-pyridin-1-yl)ethyl]-4-fluoro-2-(trifluoromethylsulfonyl)aniline |
|---|---|
| PubChem CID | 100642163 |
| Molecular Formula | C14H16F4N2O2S |
| Molecular Weight | 352.35 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | N-[2-(3,6-dihydro-2H-pyridin-1-yl)ethyl]-4-fluoro-2-(trifluoromethylsulfonyl)aniline |
| SMILES | O=S(=O)(c1cc(F)ccc1NCCN1CC=CCC1)C(F)(F)F |
| InChI | InChI=1S/C14H16F4N2O2S/c15-11-4-5-12(13(10-11)23(21,22)14(16,17)18)19-6-9-20-7-2-1-3-8-20/h1-2,4-5,10,19H,3,6-9H2 |
| InChIKey | SZGPBEZLYIOSSU-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.35 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|