C14H24N4O2S — CID 107163046
3-amino-4-[(1,4-dimethylpiperidin-4-yl)methylamino]benzenesulfonamide (PubChem CID 107163046) has the molecular formula C14H24N4O2S and a molecular weight of 312.44 g/mol. Its IUPAC name is 3-amino-4-[(1,4-dimethylpiperidin-4-yl)methylamino]benzenesulfonamide.
| Compound Name | 3-amino-4-[(1,4-dimethylpiperidin-4-yl)methylamino]benzenesulfonamide |
|---|---|
| PubChem CID | 107163046 |
| Molecular Formula | C14H24N4O2S |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 3-amino-4-[(1,4-dimethylpiperidin-4-yl)methylamino]benzenesulfonamide |
| SMILES | CN1CCC(C)(CNc2ccc(S(N)(=O)=O)cc2N)CC1 |
| InChI | InChI=1S/C14H24N4O2S/c1-14(5-7-18(2)8-6-14)10-17-13-4-3-11(9-12(13)15)21(16,19)20/h3-4,9,17H,5-8,10,15H2,1-2H3,(H2,16,19,20) |
| InChIKey | PAVZNVSKVGUSPC-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 101.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|